C62H118N2O11 — CID 178117506
7-(4,4-diheptoxybutanoyloxy)heptyl 1-[5-(4,4-dioctoxybutanoyloxy)pentyl]-4-(3-pyrrolidin-1-ylpropoxy)pyrrolidine-2-carboxylate (PubChem CID 178117506) has the molecular formula C62H118N2O11 and a molecular weight of 1067.63 g/mol. Its IUPAC name is 7-(4,4-diheptoxybutanoyloxy)heptyl 1-[5-(4,4-dioctoxybutanoyloxy)pentyl]-4-(3-pyrrolidin-1-ylpropoxy)pyrrolidine-2-carboxylate.
| Compound Name | 7-(4,4-diheptoxybutanoyloxy)heptyl 1-[5-(4,4-dioctoxybutanoyloxy)pentyl]-4-(3-pyrrolidin-1-ylpropoxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 178117506 |
| Molecular Formula | C62H118N2O11 |
| Molecular Weight | 1067.63 g/mol |
| Exact Mass | 1066.87 |
| IUPAC Name | 7-(4,4-diheptoxybutanoyloxy)heptyl 1-[5-(4,4-dioctoxybutanoyloxy)pentyl]-4-(3-pyrrolidin-1-ylpropoxy)pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCOC(CCC(=O)OCCCCCN1CC(OCCCN2CCCC2)CC1C(=O)OCCCCCCCOC(=O)CCC(OCCCCCCC)OCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C62H118N2O11/c1-5-9-13-17-22-33-50-73-61(74-51-34-23-18-14-10-6-2)41-39-59(66)70-47-36-26-27-45-64-55-56(68-53-37-44-63-42-28-29-43-63)54-57(64)62(67)75-52-35-25-19-24-30-46-69-58(65)38-40-60(71-48-31-20-15-11-7-3)72-49-32-21-16-12-8-4/h56-57,60-61H,5-55H2,1-4H3 |
| InChIKey | ACWVBQOMVIGTCH-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 131.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.63 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|