C58H107N3O11 — CID 177227032
1-O-[1-[5-(4,4-diheptoxybutanoyloxy)pentanoyl]-5-[2-(4-methylpiperazin-1-yl)ethoxycarbonyl]pyrrolidin-3-yl] 6-O-heptadecan-9-yl hexanedioate (PubChem CID 177227032) has the molecular formula C58H107N3O11 and a molecular weight of 1022.50 g/mol. Its IUPAC name is 1-O-[1-[5-(4,4-diheptoxybutanoyloxy)pentanoyl]-5-[2-(4-methylpiperazin-1-yl)ethoxycarbonyl]pyrrolidin-3-yl] 6-O-heptadecan-9-yl hexanedioate.
| Compound Name | 1-O-[1-[5-(4,4-diheptoxybutanoyloxy)pentanoyl]-5-[2-(4-methylpiperazin-1-yl)ethoxycarbonyl]pyrrolidin-3-yl] 6-O-heptadecan-9-yl hexanedioate |
|---|---|
| PubChem CID | 177227032 |
| Molecular Formula | C58H107N3O11 |
| Molecular Weight | 1022.50 g/mol |
| Exact Mass | 1021.79 |
| IUPAC Name | 1-O-[1-[5-(4,4-diheptoxybutanoyloxy)pentanoyl]-5-[2-(4-methylpiperazin-1-yl)ethoxycarbonyl]pyrrolidin-3-yl] 6-O-heptadecan-9-yl hexanedioate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCC(=O)OC1CC(C(=O)OCCN2CCN(C)CC2)N(C(=O)CCCCOC(=O)CCC(OCCCCCCC)OCCCCCCC)C1 |
| InChI | InChI=1S/C58H107N3O11/c1-6-10-14-18-20-24-32-50(33-25-21-19-15-11-7-2)71-55(64)35-26-27-36-56(65)72-51-48-52(58(66)70-47-43-60-41-39-59(5)40-42-60)61(49-51)53(62)34-28-31-44-67-54(63)37-38-57(68-45-29-22-16-12-8-3)69-46-30-23-17-13-9-4/h50-52,57H,6-49H2,1-5H3 |
| InChIKey | RSHGCMZKHIVFHP-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 150.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.50 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|