C53H98N2O7 — CID 177227089
[(8Z,11Z)-heptadeca-8,11-dienyl] 1-[4-(4,4-dioctoxybutanoyloxy)butyl]-4-(3-pyrrolidin-1-ylpropoxy)pyrrolidine-2-carboxylate (PubChem CID 177227089) has the molecular formula C53H98N2O7 and a molecular weight of 875.37 g/mol. Its IUPAC name is [(8Z,11Z)-heptadeca-8,11-dienyl] 1-[4-(4,4-dioctoxybutanoyloxy)butyl]-4-(3-pyrrolidin-1-ylpropoxy)pyrrolidine-2-carboxylate.
| Compound Name | [(8Z,11Z)-heptadeca-8,11-dienyl] 1-[4-(4,4-dioctoxybutanoyloxy)butyl]-4-(3-pyrrolidin-1-ylpropoxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 177227089 |
| Molecular Formula | C53H98N2O7 |
| Molecular Weight | 875.37 g/mol |
| Exact Mass | 874.74 |
| IUPAC Name | [(8Z,11Z)-heptadeca-8,11-dienyl] 1-[4-(4,4-dioctoxybutanoyloxy)butyl]-4-(3-pyrrolidin-1-ylpropoxy)pyrrolidine-2-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCOC(=O)C1CC(OCCCN2CCCC2)CN1CCCCOC(=O)CCC(OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C53H98N2O7/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-27-33-45-62-53(57)50-47-49(58-46-35-40-54-38-28-29-39-54)48-55(50)41-30-34-42-59-51(56)36-37-52(60-43-31-25-14-11-8-5-2)61-44-32-26-15-12-9-6-3/h16-17,19-20,49-50,52H,4-15,18,21-48H2,1-3H3/b17-16-,20-19- |
| InChIKey | UBMQFYOIFSSXRO-LTXDKZCQSA-N |
| XLogP | 13.08 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.37 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|