C37H68NO9+ — CID 178021828
[3-(azepan-1-yl)propoxy-[2-(4,4-dioctoxybutanoyloxymethyl)-3-prop-2-enoyloxypropoxy]methylidene]oxidanium (PubChem CID 178021828) has the molecular formula C37H68NO9+ and a molecular weight of 670.95 g/mol. Its IUPAC name is [3-(azepan-1-yl)propoxy-[2-(4,4-dioctoxybutanoyloxymethyl)-3-prop-2-enoyloxypropoxy]methylidene]oxidanium.
| Compound Name | [3-(azepan-1-yl)propoxy-[2-(4,4-dioctoxybutanoyloxymethyl)-3-prop-2-enoyloxypropoxy]methylidene]oxidanium |
|---|---|
| PubChem CID | 178021828 |
| Molecular Formula | C37H68NO9+ |
| Molecular Weight | 670.95 g/mol |
| Exact Mass | 670.49 |
| IUPAC Name | [3-(azepan-1-yl)propoxy-[2-(4,4-dioctoxybutanoyloxymethyl)-3-prop-2-enoyloxypropoxy]methylidene]oxidanium |
| SMILES | [H]/[O+]=C(/OCCCN1CCCCCC1)OCC(COC(=O)C=C)COC(=O)CCC(OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C37H67NO9/c1-4-7-9-11-15-19-27-42-36(43-28-20-16-12-10-8-5-2)23-22-35(40)46-31-33(30-45-34(39)6-3)32-47-37(41)44-29-21-26-38-24-17-13-14-18-25-38/h6,33,36H,3-5,7-32H2,1-2H3/p+1 |
| InChIKey | KVKJLSHJOFGFRI-UHFFFAOYSA-O |
| XLogP | 7.49 |
| TPSA | 114.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.95 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|