C24H29N5O3 — CID 178157902
N-[1-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-3-cyclopentyl-1-oxopropan-2-yl]-3-pyridin-3-yloxybenzamide (PubChem CID 178157902) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[1-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-3-cyclopentyl-1-oxopropan-2-yl]-3-pyridin-3-yloxybenzamide.
| Compound Name | N-[1-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-3-cyclopentyl-1-oxopropan-2-yl]-3-pyridin-3-yloxybenzamide |
|---|---|
| PubChem CID | 178157902 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[1-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-3-cyclopentyl-1-oxopropan-2-yl]-3-pyridin-3-yloxybenzamide |
| SMILES | C/N=C/C(=C\N)NC(=O)C(CC1CCCC1)NC(=O)c1cccc(Oc2cccnc2)c1 |
| InChI | InChI=1S/C24H29N5O3/c1-26-15-19(14-25)28-24(31)22(12-17-6-2-3-7-17)29-23(30)18-8-4-9-20(13-18)32-21-10-5-11-27-16-21/h4-5,8-11,13-17,22H,2-3,6-7,12,25H2,1H3,(H,28,31)(H,29,30)/b19-14+,26-15+ |
| InChIKey | ZFJISOGZXPIMHF-PNAHMVSWSA-N |
| XLogP | 3.17 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|