C17H32N2 — CID 178160236
1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene (PubChem CID 178160236) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene.
| Compound Name | 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene |
|---|---|
| PubChem CID | 178160236 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene |
| SMILES | C=CC.CCC(C)CCCC(C)c1cn(C)c(C)n1 |
| InChI | InChI=1S/C14H26N2.C3H6/c1-6-11(2)8-7-9-12(3)14-10-16(5)13(4)15-14;1-3-2/h10-12H,6-9H2,1-5H3;3H,1H2,2H3 |
| InChIKey | TZKZHPNNRAQBLT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|