About 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene
1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene (PubChem CID 178160236) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene.
Molecular Properties
| Compound Name | 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene |
| PubChem CID | 178160236 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene |
| SMILES | C=CC.CCC(C)CCCC(C)c1cn(C)c(C)n1 |
| InChI | InChI=1S/C14H26N2.C3H6/c1-6-11(2)8-7-9-12(3)14-10-16(5)13(4)15-14;1-3-2/h10-12H,6-9H2,1-5H3;3H,1H2,2H3 |
| InChIKey | TZKZHPNNRAQBLT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene?
The IUPAC name of 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene (CID 178160236) is 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene.
What is the SMILES notation for 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene?
The canonical SMILES for 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene is C=CC.CCC(C)CCCC(C)c1cn(C)c(C)n1.
What is the InChIKey of 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene?
The InChIKey is TZKZHPNNRAQBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2.C3H6/c1-6-11(2)8-7-9-12(3)14-10-16(5)13(4)15-14;1-3-2/h10-12H,6-9H2,1-5H3;3H,1H2,2H3.
What are the key properties of 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene?
1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene has a molecular weight of 264.46 g/mol, XLogP of 5.24, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4-(6-methyloctan-2-yl)imidazole;prop-1-ene is sourced from PubChem (CID 178160236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).