C23H23NO2S — CID 178178473
(NE,S)-2-methyl-N-[(2R)-2-phenyl-2,3-dihydrobenzo[g]chromen-4-ylidene]propane-2-sulfinamide (PubChem CID 178178473) has the molecular formula C23H23NO2S and a molecular weight of 377.51 g/mol. Its IUPAC name is (NE,S)-2-methyl-N-[(2R)-2-phenyl-2,3-dihydrobenzo[g]chromen-4-ylidene]propane-2-sulfinamide.
| Compound Name | (NE,S)-2-methyl-N-[(2R)-2-phenyl-2,3-dihydrobenzo[g]chromen-4-ylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 178178473 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (NE,S)-2-methyl-N-[(2R)-2-phenyl-2,3-dihydrobenzo[g]chromen-4-ylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)/N=C1\C[C@H](c2ccccc2)Oc2cc3ccccc3cc21 |
| InChI | InChI=1S/C23H23NO2S/c1-23(2,3)27(25)24-20-15-21(16-9-5-4-6-10-16)26-22-14-18-12-8-7-11-17(18)13-19(20)22/h4-14,21H,15H2,1-3H3/b24-20+/t21-,27+/m1/s1 |
| InChIKey | JVHKYWOKQJNFKS-GDJMMAEUSA-N |
| XLogP | 5.61 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|