C23H22N2O3S — CID 3955887
2,5-dimethyl-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide (PubChem CID 3955887) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 3955887 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2,5-dimethyl-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NN=C2CC(c3ccccc3)Oc3ccccc32)c1 |
| InChI | InChI=1S/C23H22N2O3S/c1-16-12-13-17(2)23(14-16)29(26,27)25-24-20-15-22(18-8-4-3-5-9-18)28-21-11-7-6-10-19(20)21/h3-14,22,25H,15H2,1-2H3 |
| InChIKey | ODSGGVLVNSOGPK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|