C22H20N2O2S — CID 2326133
N-(10H-anthracen-9-ylideneamino)-2,5-dimethylbenzenesulfonamide (PubChem CID 2326133) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(10H-anthracen-9-ylideneamino)-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(10H-anthracen-9-ylideneamino)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2326133 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-(10H-anthracen-9-ylideneamino)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NN=C2c3ccccc3Cc3ccccc32)c1 |
| InChI | InChI=1S/C22H20N2O2S/c1-15-11-12-16(2)21(13-15)27(25,26)24-23-22-19-9-5-3-7-17(19)14-18-8-4-6-10-20(18)22/h3-13,24H,14H2,1-2H3 |
| InChIKey | JHDTUJFZUWUZDY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|