C24H25ClFN3O2 — CID 178185442
(3S,4S)-4-(2-chlorophenyl)-11-fluoro-3-[(3R)-1-(2-methoxyethyl)pyrrolidin-3-yl]-2,6-diazatricyclo[7.3.1.05,13]trideca-1(12),5,9(13),10-tetraen-8-one (PubChem CID 178185442) has the molecular formula C24H25ClFN3O2 and a molecular weight of 441.93 g/mol. Its IUPAC name is (3S,4S)-4-(2-chlorophenyl)-11-fluoro-3-[(3R)-1-(2-methoxyethyl)pyrrolidin-3-yl]-2,6-diazatricyclo[7.3.1.05,13]trideca-1(12),5,9(13),10-tetraen-8-one.
| Compound Name | (3S,4S)-4-(2-chlorophenyl)-11-fluoro-3-[(3R)-1-(2-methoxyethyl)pyrrolidin-3-yl]-2,6-diazatricyclo[7.3.1.05,13]trideca-1(12),5,9(13),10-tetraen-8-one |
|---|---|
| PubChem CID | 178185442 |
| Molecular Formula | C24H25ClFN3O2 |
| Molecular Weight | 441.93 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (3S,4S)-4-(2-chlorophenyl)-11-fluoro-3-[(3R)-1-(2-methoxyethyl)pyrrolidin-3-yl]-2,6-diazatricyclo[7.3.1.05,13]trideca-1(12),5,9(13),10-tetraen-8-one |
| SMILES | COCCN1CC[C@@H]([C@@H]2Nc3cc(F)cc4c3C(=NCC4=O)[C@H]2c2ccccc2Cl)C1 |
| InChI | InChI=1S/C24H25ClFN3O2/c1-31-9-8-29-7-6-14(13-29)23-22(16-4-2-3-5-18(16)25)24-21-17(20(30)12-27-24)10-15(26)11-19(21)28-23/h2-5,10-11,14,22-23,28H,6-9,12-13H2,1H3/t14-,22+,23+/m1/s1 |
| InChIKey | GTOYVVJITNBNSI-ILFDSTAHSA-N |
| XLogP | 4.01 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |