C18H21N — CID 178197780
cis-(1R,3S)-3-benzhydryl-2,2-dimethylcyclopropan-1-amine (PubChem CID 178197780) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is cis-(1R,3S)-3-benzhydryl-2,2-dimethylcyclopropan-1-amine.
| Compound Name | cis-(1R,3S)-3-benzhydryl-2,2-dimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 178197780 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | cis-(1R,3S)-3-benzhydryl-2,2-dimethylcyclopropan-1-amine |
| SMILES | CC1(C)[C@H](N)[C@H]1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-18(2)16(17(18)19)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-17H,19H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | NVTVECXLMRMORG-IAGOWNOFSA-N |
| XLogP | 3.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |