C19H26N3NaO6 — CID 178201338
sodium 2-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]acetate (PubChem CID 178201338) has the molecular formula C19H26N3NaO6 and a molecular weight of 415.42 g/mol. Its IUPAC name is sodium 2-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]acetate.
| Compound Name | sodium 2-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 178201338 |
| Molecular Formula | C19H26N3NaO6 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | sodium 2-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]acetate |
| SMILES | O=C([O-])CNC(=O)C1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O.[Na+] |
| InChI | InChI=1S/C19H27N3O6.Na/c23-14(24)11-20-16(25)15-17(26)21(12-7-3-1-4-8-12)19(28)22(18(15)27)13-9-5-2-6-10-13;/h12-13,15H,1-11H2,(H,20,25)(H,23,24);/q;+1/p-1 |
| InChIKey | DLNPXTJEMWGESK-UHFFFAOYSA-M |
| XLogP | -3.07 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|