C12H15N3O3 — CID 18008900
ethyl 7-amino-6-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-2-carboxylate (PubChem CID 18008900) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is ethyl 7-amino-6-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-2-carboxylate.
| Compound Name | ethyl 7-amino-6-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 18008900 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | ethyl 7-amino-6-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)C1Nc2cc(N)c(C)cc2NC1=O |
| InChI | InChI=1S/C12H15N3O3/c1-3-18-12(17)10-11(16)15-8-4-6(2)7(13)5-9(8)14-10/h4-5,10,14H,3,13H2,1-2H3,(H,15,16) |
| InChIKey | UYOWLCUJPOGPIA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|