C11H10BrNO3S — CID 90743664
ethyl 7-bromo-3-oxo-4H-1,4-benzothiazine-2-carboxylate (PubChem CID 90743664) has the molecular formula C11H10BrNO3S and a molecular weight of 316.18 g/mol. Its IUPAC name is ethyl 7-bromo-3-oxo-4H-1,4-benzothiazine-2-carboxylate.
| Compound Name | ethyl 7-bromo-3-oxo-4H-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 90743664 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | ethyl 7-bromo-3-oxo-4H-1,4-benzothiazine-2-carboxylate |
| SMILES | CCOC(=O)C1Sc2cc(Br)ccc2NC1=O |
| InChI | InChI=1S/C11H10BrNO3S/c1-2-16-11(15)9-10(14)13-7-4-3-6(12)5-8(7)17-9/h3-5,9H,2H2,1H3,(H,13,14) |
| InChIKey | FVEOQVLUXUQBGC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|