C26H30N2O4 — CID 18009518
prop-2-enyl N-[4-[(2,3-dihydro-1-benzofuran-7-carbonylamino)methyl]-4-phenylcyclohexyl]carbamate (PubChem CID 18009518) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is prop-2-enyl N-[4-[(2,3-dihydro-1-benzofuran-7-carbonylamino)methyl]-4-phenylcyclohexyl]carbamate.
| Compound Name | prop-2-enyl N-[4-[(2,3-dihydro-1-benzofuran-7-carbonylamino)methyl]-4-phenylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 18009518 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | prop-2-enyl N-[4-[(2,3-dihydro-1-benzofuran-7-carbonylamino)methyl]-4-phenylcyclohexyl]carbamate |
| SMILES | C=CCOC(=O)NC1CCC(CNC(=O)c2cccc3c2OCC3)(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N2O4/c1-2-16-32-25(30)28-21-11-14-26(15-12-21,20-8-4-3-5-9-20)18-27-24(29)22-10-6-7-19-13-17-31-23(19)22/h2-10,21H,1,11-18H2,(H,27,29)(H,28,30) |
| InChIKey | MALACGYJOAJWHC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|