C15H14N4O3 — CID 18100353
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(1H-indol-3-yl)ethanone (PubChem CID 18100353) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 18100353 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(1H-indol-3-yl)ethanone |
| SMILES | Cc1nn(CC(=O)c2c[nH]c3ccccc23)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N4O3/c1-9-15(19(21)22)10(2)18(17-9)8-14(20)12-7-16-13-6-4-3-5-11(12)13/h3-7,16H,8H2,1-2H3 |
| InChIKey | AFTOIOSLWSSXQY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|