C19H21N3O3S — CID 18170091
[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-pyrrol-1-ylthiophene-2-carboxylate (PubChem CID 18170091) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-pyrrol-1-ylthiophene-2-carboxylate.
| Compound Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-pyrrol-1-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 18170091 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-pyrrol-1-ylthiophene-2-carboxylate |
| SMILES | CC(OC(=O)c1sccc1-n1cccc1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C19H21N3O3S/c1-14(17(23)21-19(13-20)8-3-2-4-9-19)25-18(24)16-15(7-12-26-16)22-10-5-6-11-22/h5-7,10-12,14H,2-4,8-9H2,1H3,(H,21,23) |
| InChIKey | WRECQOBHUDPBTF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |