C47H56N2O7 — CID 18174201
N-(4-butoxyphenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine (PubChem CID 18174201) has the molecular formula C47H56N2O7 and a molecular weight of 760.97 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-(4-butoxyphenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 18174201 |
| Molecular Formula | C47H56N2O7 |
| Molecular Weight | 760.97 g/mol |
| Exact Mass | 760.41 |
| IUPAC Name | N-(4-butoxyphenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine |
| SMILES | CCCCOc1ccc(N(Cc2cccc(-c3cc(OC)c(OC)c(OC)c3)c2)C2CCN(Cc3cccc(-c4cc(OC)c(OC)c(OC)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C47H56N2O7/c1-8-9-24-56-41-18-16-39(17-19-41)49(32-34-13-11-15-36(26-34)38-29-44(52-4)47(55-7)45(30-38)53-5)40-20-22-48(23-21-40)31-33-12-10-14-35(25-33)37-27-42(50-2)46(54-6)43(28-37)51-3/h10-19,25-30,40H,8-9,20-24,31-32H2,1-7H3 |
| InChIKey | USXJAMSITDOSST-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 71.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.97 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|