C20H24N2O6 — CID 18266662
[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate (PubChem CID 18266662) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate.
| Compound Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
|---|---|
| PubChem CID | 18266662 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
| SMILES | CCN(C(=O)COC(=O)CO/N=C(\C)c1ccc2c(c1)OCO2)C1=CCCC1 |
| InChI | InChI=1S/C20H24N2O6/c1-3-22(16-6-4-5-7-16)19(23)11-25-20(24)12-28-21-14(2)15-8-9-17-18(10-15)27-13-26-17/h6,8-10H,3-5,7,11-13H2,1-2H3/b21-14+ |
| InChIKey | BXSHTYAPZLDIOX-KGENOOAVSA-N |
| XLogP | 2.62 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|