C16H18N6O4 — CID 18286847
(1-butyltetrazol-5-yl)methyl 2-(2,4-dioxoquinazolin-1-yl)acetate (PubChem CID 18286847) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-(2,4-dioxoquinazolin-1-yl)acetate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-(2,4-dioxoquinazolin-1-yl)acetate |
|---|---|
| PubChem CID | 18286847 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-(2,4-dioxoquinazolin-1-yl)acetate |
| SMILES | CCCCn1nnnc1COC(=O)Cn1c(=O)[nH]c(=O)c2ccccc21 |
| InChI | InChI=1S/C16H18N6O4/c1-2-3-8-22-13(18-19-20-22)10-26-14(23)9-21-12-7-5-4-6-11(12)15(24)17-16(21)25/h4-7H,2-3,8-10H2,1H3,(H,17,24,25) |
| InChIKey | BUJHWHTTYTZSIX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |