C19H29NO3S — CID 18325695
N-(4-tert-butylphenyl)sulfonyl-N-cyclohexylpropanamide (PubChem CID 18325695) has the molecular formula C19H29NO3S and a molecular weight of 351.51 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)sulfonyl-N-cyclohexylpropanamide.
| Compound Name | N-(4-tert-butylphenyl)sulfonyl-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 18325695 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(4-tert-butylphenyl)sulfonyl-N-cyclohexylpropanamide |
| SMILES | CCC(=O)N(C1CCCCC1)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO3S/c1-5-18(21)20(16-9-7-6-8-10-16)24(22,23)17-13-11-15(12-14-17)19(2,3)4/h11-14,16H,5-10H2,1-4H3 |
| InChIKey | MFIHEIDLMCTCDR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |