C28H30N4O — CID 18334430
2-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxypropanenitrile (PubChem CID 18334430) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxypropanenitrile.
| Compound Name | 2-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxypropanenitrile |
|---|---|
| PubChem CID | 18334430 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 2-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxypropanenitrile |
| SMILES | Cc1ccc2/c(=N/OC(C)C#N)c3ccccc3n(CCCNCc3ccccc3)c2c1C |
| InChI | InChI=1S/C28H30N4O/c1-20-14-15-25-27(31-33-21(2)18-29)24-12-7-8-13-26(24)32(28(25)22(20)3)17-9-16-30-19-23-10-5-4-6-11-23/h4-8,10-15,21,30H,9,16-17,19H2,1-3H3/b31-27+ |
| InChIKey | LNWUZQHGUOMRSS-TVKQRKNISA-N |
| XLogP | 5.34 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|