C21H25N3O3 — CID 18334425
2-[(E)-[10-(3-aminopropyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid (PubChem CID 18334425) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[(E)-[10-(3-aminopropyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid.
| Compound Name | 2-[(E)-[10-(3-aminopropyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 18334425 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[(E)-[10-(3-aminopropyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid |
| SMILES | Cc1ccc2/c(=N/OC(C)C(=O)O)c3ccccc3n(CCCN)c2c1C |
| InChI | InChI=1S/C21H25N3O3/c1-13-9-10-17-19(23-27-15(3)21(25)26)16-7-4-5-8-18(16)24(12-6-11-22)20(17)14(13)2/h4-5,7-10,15H,6,11-12,22H2,1-3H3,(H,25,26)/b23-19+ |
| InChIKey | GBAPHVBEHVIPLH-FCDQGJHFSA-N |
| XLogP | 3.07 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|