About 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid
3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid (PubChem CID 73430428) has the molecular formula C20H23N3O3
and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid.
Molecular Properties
| Compound Name | 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid |
| PubChem CID | 73430428 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid |
| SMILES | Cc1ccc2c(=NOCCC(=O)O)c3ccccc3n(CCN)c2c1C |
| InChI | InChI=1S/C20H23N3O3/c1-13-7-8-16-19(22-26-12-9-18(24)25)15-5-3-4-6-17(15)23(11-10-21)20(16)14(13)2/h3-8H,9-12,21H2,1-2H3,(H,24,25) |
| InChIKey | WNYOEWKYXLDFQV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid?
The IUPAC name of 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid (CID 73430428) is 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid.
What is the SMILES notation for 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid?
The canonical SMILES for 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid is Cc1ccc2c(=NOCCC(=O)O)c3ccccc3n(CCN)c2c1C.
What is the InChIKey of 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid?
The InChIKey is WNYOEWKYXLDFQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O3/c1-13-7-8-16-19(22-26-12-9-18(24)25)15-5-3-4-6-17(15)23(11-10-21)20(16)14(13)2/h3-8H,9-12,21H2,1-2H3,(H,24,25).
What are the key properties of 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid?
3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid has a molecular weight of 353.42 g/mol, XLogP of 2.68, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[10-(2-aminoethyl)-3,4-dimethylacridin-9-ylidene]amino]oxypropanoic acid is sourced from PubChem (CID 73430428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).