C30H37N3O3 — CID 172951890
2-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxybutanoic acid;methane (PubChem CID 172951890) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is 2-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxybutanoic acid;methane.
| Compound Name | 2-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxybutanoic acid;methane |
|---|---|
| PubChem CID | 172951890 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 2-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxybutanoic acid;methane |
| SMILES | C.CCC(O/N=c1\c2ccccc2n(CCCNCc2ccccc2)c2c(C)c(C)ccc12)C(=O)O |
| InChI | InChI=1S/C29H33N3O3.CH4/c1-4-26(29(33)34)35-31-27-23-13-8-9-14-25(23)32(28-21(3)20(2)15-16-24(27)28)18-10-17-30-19-22-11-6-5-7-12-22;/h5-9,11-16,26,30H,4,10,17-19H2,1-3H3,(H,33,34);1H4/b31-27+; |
| InChIKey | NCIGTOWDIQLATR-OVXWMHFQSA-N |
| XLogP | 5.92 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|