C56H42N2O4 — CID 18335703
5,8-bis[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]-3-isocyanonaphthalene-2-carbonitrile (PubChem CID 18335703) has the molecular formula C56H42N2O4 and a molecular weight of 806.96 g/mol. Its IUPAC name is 5,8-bis[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]-3-isocyanonaphthalene-2-carbonitrile.
| Compound Name | 5,8-bis[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]-3-isocyanonaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 18335703 |
| Molecular Formula | C56H42N2O4 |
| Molecular Weight | 806.96 g/mol |
| Exact Mass | 806.31 |
| IUPAC Name | 5,8-bis[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]-3-isocyanonaphthalene-2-carbonitrile |
| SMILES | [C-]#[N+]c1cc2c(-c3ccc(C=C(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)ccc(-c3ccc(C=C(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)c2cc1C#N |
| InChI | InChI=1S/C56H42N2O4/c1-58-56-35-55-51(40-12-8-38(9-13-40)33-53(43-18-26-48(61-4)27-19-43)44-20-28-49(62-5)29-21-44)31-30-50(54(55)34-45(56)36-57)39-10-6-37(7-11-39)32-52(41-14-22-46(59-2)23-15-41)42-16-24-47(60-3)25-17-42/h6-35H,2-5H3 |
| InChIKey | RDGRJCKRVKXFQW-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.96 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|