C22H23N7O5 — CID 18336827
(2R,3R,4S,5S)-2-[6-(oxan-4-ylamino)purin-9-yl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol (PubChem CID 18336827) has the molecular formula C22H23N7O5 and a molecular weight of 465.47 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[6-(oxan-4-ylamino)purin-9-yl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[6-(oxan-4-ylamino)purin-9-yl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 18336827 |
| Molecular Formula | C22H23N7O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (2R,3R,4S,5S)-2-[6-(oxan-4-ylamino)purin-9-yl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](c2nc(-c3ccccc3)no2)O[C@H]1n1cnc2c(NC3CCOCC3)ncnc21 |
| InChI | InChI=1S/C22H23N7O5/c30-15-16(31)22(33-17(15)21-27-18(28-34-21)12-4-2-1-3-5-12)29-11-25-14-19(23-10-24-20(14)29)26-13-6-8-32-9-7-13/h1-5,10-11,13,15-17,22,30-31H,6-9H2,(H,23,24,26)/t15-,16+,17-,22+/m0/s1 |
| InChIKey | OYBJWZDJCJNMCP-DVSDUFGPSA-N |
| XLogP | 1.46 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |