C24H25ClN6O4S — CID 91274810
(2R,3S,4R,5R)-2-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]sulfanylmethyl]-5-[6-(cyclopentylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 91274810) has the molecular formula C24H25ClN6O4S and a molecular weight of 529.02 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]sulfanylmethyl]-5-[6-(cyclopentylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]sulfanylmethyl]-5-[6-(cyclopentylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 91274810 |
| Molecular Formula | C24H25ClN6O4S |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]sulfanylmethyl]-5-[6-(cyclopentylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H](CSc2cc(-c3ccccc3Cl)no2)O[C@H]1n1cnc2c(NC3CCCC3)ncnc21 |
| InChI | InChI=1S/C24H25ClN6O4S/c25-15-8-4-3-7-14(15)16-9-18(35-30-16)36-10-17-20(32)21(33)24(34-17)31-12-28-19-22(26-11-27-23(19)31)29-13-5-1-2-6-13/h3-4,7-9,11-13,17,20-21,24,32-33H,1-2,5-6,10H2,(H,26,27,29)/t17-,20+,21+,24+/m0/s1 |
| InChIKey | UJCZBBZGYFRPLY-FCIXZNIRSA-N |
| XLogP | 3.90 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |