C24H26N6O5S — CID 66696785
(2R,3S,4R,5R)-2-[6-(oxolan-3-ylamino)purin-9-yl]-5-[(3-phenyl-1,2-oxazol-5-yl)methylsulfanylmethyl]oxolane-3,4-diol (PubChem CID 66696785) has the molecular formula C24H26N6O5S and a molecular weight of 510.58 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[6-(oxolan-3-ylamino)purin-9-yl]-5-[(3-phenyl-1,2-oxazol-5-yl)methylsulfanylmethyl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[6-(oxolan-3-ylamino)purin-9-yl]-5-[(3-phenyl-1,2-oxazol-5-yl)methylsulfanylmethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 66696785 |
| Molecular Formula | C24H26N6O5S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (2R,3S,4R,5R)-2-[6-(oxolan-3-ylamino)purin-9-yl]-5-[(3-phenyl-1,2-oxazol-5-yl)methylsulfanylmethyl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H](n2cnc3c(NC4CCOC4)ncnc32)O[C@H]1CSCc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C24H26N6O5S/c31-20-18(11-36-10-16-8-17(29-35-16)14-4-2-1-3-5-14)34-24(21(20)32)30-13-27-19-22(25-12-26-23(19)30)28-15-6-7-33-9-15/h1-5,8,12-13,15,18,20-21,24,31-32H,6-7,9-11H2,(H,25,26,28)/t15?,18-,20-,21-,24+/m0/s1 |
| InChIKey | AFOTXWCGYXAPMF-QEWOBZOASA-N |
| XLogP | 2.23 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |