C12H14NO6S2- — CID 18346527
3-(3,4-dihydroisoquinolin-2-ium-2-yl)propane-1,2-disulfonate (PubChem CID 18346527) has the molecular formula C12H14NO6S2- and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-(3,4-dihydroisoquinolin-2-ium-2-yl)propane-1,2-disulfonate.
| Compound Name | 3-(3,4-dihydroisoquinolin-2-ium-2-yl)propane-1,2-disulfonate |
|---|---|
| PubChem CID | 18346527 |
| Molecular Formula | C12H14NO6S2- |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 3-(3,4-dihydroisoquinolin-2-ium-2-yl)propane-1,2-disulfonate |
| SMILES | O=S(=O)([O-])CC(C[N+]1=Cc2ccccc2CC1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C12H15NO6S2/c14-20(15,16)9-12(21(17,18)19)8-13-6-5-10-3-1-2-4-11(10)7-13/h1-4,7,12H,5-6,8-9H2,(H-,14,15,16,17,18,19)/p-1 |
| InChIKey | XYAHUCLCHBKEMP-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 117.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|