C13H18NO6S2+ — CID 18346530
4-(3,4-dihydroisoquinolin-2-ium-2-yl)butane-1,2-disulfonic acid (PubChem CID 18346530) has the molecular formula C13H18NO6S2+ and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-(3,4-dihydroisoquinolin-2-ium-2-yl)butane-1,2-disulfonic acid.
| Compound Name | 4-(3,4-dihydroisoquinolin-2-ium-2-yl)butane-1,2-disulfonic acid |
|---|---|
| PubChem CID | 18346530 |
| Molecular Formula | C13H18NO6S2+ |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 4-(3,4-dihydroisoquinolin-2-ium-2-yl)butane-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)CC(CC[N+]1=Cc2ccccc2CC1)S(=O)(=O)O |
| InChI | InChI=1S/C13H17NO6S2/c15-21(16,17)10-13(22(18,19)20)6-8-14-7-5-11-3-1-2-4-12(11)9-14/h1-4,9,13H,5-8,10H2,(H-,15,16,17,18,19,20)/p+1 |
| InChIKey | IKEWZGPMMTVKLL-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|