C12H16NO6S2+ — CID 18346528
3-(3,4-dihydroisoquinolin-2-ium-2-yl)propane-1,2-disulfonic acid (PubChem CID 18346528) has the molecular formula C12H16NO6S2+ and a molecular weight of 334.39 g/mol. Its IUPAC name is 3-(3,4-dihydroisoquinolin-2-ium-2-yl)propane-1,2-disulfonic acid.
| Compound Name | 3-(3,4-dihydroisoquinolin-2-ium-2-yl)propane-1,2-disulfonic acid |
|---|---|
| PubChem CID | 18346528 |
| Molecular Formula | C12H16NO6S2+ |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-(3,4-dihydroisoquinolin-2-ium-2-yl)propane-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)CC(C[N+]1=Cc2ccccc2CC1)S(=O)(=O)O |
| InChI | InChI=1S/C12H15NO6S2/c14-20(15,16)9-12(21(17,18)19)8-13-6-5-10-3-1-2-4-11(10)7-13/h1-4,7,12H,5-6,8-9H2,(H-,14,15,16,17,18,19)/p+1 |
| InChIKey | XYAHUCLCHBKEMP-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|