C17H22F6N2O4S2 — CID 66559511
bis(trifluoromethylsulfonyl)azanide;2-hexyl-3,4-dihydroisoquinolin-2-ium (PubChem CID 66559511) has the molecular formula C17H22F6N2O4S2 and a molecular weight of 496.50 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;2-hexyl-3,4-dihydroisoquinolin-2-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;2-hexyl-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 66559511 |
| Molecular Formula | C17H22F6N2O4S2 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;2-hexyl-3,4-dihydroisoquinolin-2-ium |
| SMILES | CCCCCC[N+]1=Cc2ccccc2CC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H22N.C2F6NO4S2/c1-2-3-4-7-11-16-12-10-14-8-5-6-9-15(14)13-16;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-6,8-9,13H,2-4,7,10-12H2,1H3;/q+1;-1 |
| InChIKey | FDUBIFGEJJIEPD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|