C14H20F3NO3SSi — CID 10666662
3,4-dihydroisoquinolin-2-ium-2-ylmethyl(trimethyl)silane;trifluoromethanesulfonate (PubChem CID 10666662) has the molecular formula C14H20F3NO3SSi and a molecular weight of 367.47 g/mol. Its IUPAC name is 3,4-dihydroisoquinolin-2-ium-2-ylmethyl(trimethyl)silane;trifluoromethanesulfonate.
| Compound Name | 3,4-dihydroisoquinolin-2-ium-2-ylmethyl(trimethyl)silane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10666662 |
| Molecular Formula | C14H20F3NO3SSi |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3,4-dihydroisoquinolin-2-ium-2-ylmethyl(trimethyl)silane;trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)C[N+]1=Cc2ccccc2CC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H20NSi.CHF3O3S/c1-15(2,3)11-14-9-8-12-6-4-5-7-13(12)10-14;2-1(3,4)8(5,6)7/h4-7,10H,8-9,11H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | CUUJJJDXBCNFIV-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|