C19H29NO3S — CID 172778416
1-(3,4-dihydroisoquinolin-2-ium-2-yl)decane-2-sulfonate (PubChem CID 172778416) has the molecular formula C19H29NO3S and a molecular weight of 351.51 g/mol. Its IUPAC name is 1-(3,4-dihydroisoquinolin-2-ium-2-yl)decane-2-sulfonate.
| Compound Name | 1-(3,4-dihydroisoquinolin-2-ium-2-yl)decane-2-sulfonate |
|---|---|
| PubChem CID | 172778416 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-(3,4-dihydroisoquinolin-2-ium-2-yl)decane-2-sulfonate |
| SMILES | CCCCCCCCC(C[N+]1=Cc2ccccc2CC1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C19H29NO3S/c1-2-3-4-5-6-7-12-19(24(21,22)23)16-20-14-13-17-10-8-9-11-18(17)15-20/h8-11,15,19H,2-7,12-14,16H2,1H3 |
| InChIKey | NXPFCLPRGXRMPL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|