C13H17NO3S — CID 21044663
1-(3,4-dihydroisoquinolin-2-ium-2-yl)butane-2-sulfonate (PubChem CID 21044663) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-(3,4-dihydroisoquinolin-2-ium-2-yl)butane-2-sulfonate.
| Compound Name | 1-(3,4-dihydroisoquinolin-2-ium-2-yl)butane-2-sulfonate |
|---|---|
| PubChem CID | 21044663 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(3,4-dihydroisoquinolin-2-ium-2-yl)butane-2-sulfonate |
| SMILES | CCC(C[N+]1=Cc2ccccc2CC1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H17NO3S/c1-2-13(18(15,16)17)10-14-8-7-11-5-3-4-6-12(11)9-14/h3-6,9,13H,2,7-8,10H2,1H3 |
| InChIKey | TWYJTXXFIRBXSQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|