C16H32O4 — CID 18381158
7,7-dimethyl-2-(2-methylpentan-2-ylperoxy)octanoic acid (PubChem CID 18381158) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is 7,7-dimethyl-2-(2-methylpentan-2-ylperoxy)octanoic acid.
| Compound Name | 7,7-dimethyl-2-(2-methylpentan-2-ylperoxy)octanoic acid |
|---|---|
| PubChem CID | 18381158 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 7,7-dimethyl-2-(2-methylpentan-2-ylperoxy)octanoic acid |
| SMILES | CCCC(C)(C)OOC(CCCCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H32O4/c1-7-11-16(5,6)20-19-13(14(17)18)10-8-9-12-15(2,3)4/h13H,7-12H2,1-6H3,(H,17,18) |
| InChIKey | GWFIOTIEXJHQPR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|