C18H36O4 — CID 54030573
7,7-dimethyl-2-(2,4,4-trimethylpentylperoxy)octanoic acid (PubChem CID 54030573) has the molecular formula C18H36O4 and a molecular weight of 316.48 g/mol. Its IUPAC name is 7,7-dimethyl-2-(2,4,4-trimethylpentylperoxy)octanoic acid.
| Compound Name | 7,7-dimethyl-2-(2,4,4-trimethylpentylperoxy)octanoic acid |
|---|---|
| PubChem CID | 54030573 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 7,7-dimethyl-2-(2,4,4-trimethylpentylperoxy)octanoic acid |
| SMILES | CC(COOC(CCCCC(C)(C)C)C(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C18H36O4/c1-14(12-18(5,6)7)13-21-22-15(16(19)20)10-8-9-11-17(2,3)4/h14-15H,8-13H2,1-7H3,(H,19,20) |
| InChIKey | LFHDOPLTXADJSH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|