C12H20N3O3+ — CID 18408715
5-ethyl-5-(1-methylpiperidin-1-ium-1-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 18408715) has the molecular formula C12H20N3O3+ and a molecular weight of 254.31 g/mol. Its IUPAC name is 5-ethyl-5-(1-methylpiperidin-1-ium-1-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-5-(1-methylpiperidin-1-ium-1-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18408715 |
| Molecular Formula | C12H20N3O3+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-ethyl-5-(1-methylpiperidin-1-ium-1-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1([N+]2(C)CCCCC2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C12H19N3O3/c1-3-12(15(2)7-5-4-6-8-15)9(16)13-11(18)14-10(12)17/h3-8H2,1-2H3,(H-,13,14,16,17,18)/p+1 |
| InChIKey | JWWGQAFVTLSTJR-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|