C18H21N3O6 — CID 18432057
1,3,5-tris(3-oxopent-4-en-2-yl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 18432057) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is 1,3,5-tris(3-oxopent-4-en-2-yl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(3-oxopent-4-en-2-yl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18432057 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1,3,5-tris(3-oxopent-4-en-2-yl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CC(=O)C(C)n1c(=O)n(C(C)C(=O)C=C)c(=O)n(C(C)C(=O)C=C)c1=O |
| InChI | InChI=1S/C18H21N3O6/c1-7-13(22)10(4)19-16(25)20(11(5)14(23)8-2)18(27)21(17(19)26)12(6)15(24)9-3/h7-12H,1-3H2,4-6H3 |
| InChIKey | GSMKBPCANVKFHW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|