C20H18N2O2S — CID 18432930
3-[[2-(1-benzothiophen-2-yl)quinolin-4-yl]amino]propane-1,2-diol (PubChem CID 18432930) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is 3-[[2-(1-benzothiophen-2-yl)quinolin-4-yl]amino]propane-1,2-diol.
| Compound Name | 3-[[2-(1-benzothiophen-2-yl)quinolin-4-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 18432930 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 3-[[2-(1-benzothiophen-2-yl)quinolin-4-yl]amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cc(-c2cc3ccccc3s2)nc2ccccc12 |
| InChI | InChI=1S/C20H18N2O2S/c23-12-14(24)11-21-17-10-18(22-16-7-3-2-6-15(16)17)20-9-13-5-1-4-8-19(13)25-20/h1-10,14,23-24H,11-12H2,(H,21,22) |
| InChIKey | VDKUYRFSLNXWBO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |