C9H18N3O2- — CID 18449257
N-tert-butyl-N-piperazin-1-ylcarbamate (PubChem CID 18449257) has the molecular formula C9H18N3O2- and a molecular weight of 200.26 g/mol. Its IUPAC name is N-tert-butyl-N-piperazin-1-ylcarbamate.
| Compound Name | N-tert-butyl-N-piperazin-1-ylcarbamate |
|---|---|
| PubChem CID | 18449257 |
| Molecular Formula | C9H18N3O2- |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | N-tert-butyl-N-piperazin-1-ylcarbamate |
| SMILES | CC(C)(C)N(C(=O)[O-])N1CCNCC1 |
| InChI | InChI=1S/C9H19N3O2/c1-9(2,3)12(8(13)14)11-6-4-10-5-7-11/h10H,4-7H2,1-3H3,(H,13,14)/p-1 |
| InChIKey | AQHDKGSGDLGRES-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |