About 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline
4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline (PubChem CID 18450517) has the molecular formula C36H60N2OS2
and a molecular weight of 601.02 g/mol. Its IUPAC name is 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline.
Molecular Properties
| Compound Name | 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline |
| PubChem CID | 18450517 |
| Molecular Formula | C36H60N2OS2 |
| Molecular Weight | 601.02 g/mol |
| Exact Mass | 600.41 |
| IUPAC Name | 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline |
| SMILES | CCCCCCc1cc(SOSc2cc(CCCCCC)c(N)c(CCCCCC)c2)cc(CCCCCC)c1N |
| InChI | InChI=1S/C36H60N2OS2/c1-5-9-13-17-21-29-25-33(26-30(35(29)37)22-18-14-10-6-2)40-39-41-34-27-31(23-19-15-11-7-3)36(38)32(28-34)24-20-16-12-8-4/h25-28H,5-24,37-38H2,1-4H3 |
| InChIKey | AFJNJMPGSNGIBQ-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 601.02 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline?
The IUPAC name of 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline (CID 18450517) is 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline.
What is the SMILES notation for 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline?
The canonical SMILES for 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline is CCCCCCc1cc(SOSc2cc(CCCCCC)c(N)c(CCCCCC)c2)cc(CCCCCC)c1N.
What is the InChIKey of 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline?
The InChIKey is AFJNJMPGSNGIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H60N2OS2/c1-5-9-13-17-21-29-25-33(26-30(35(29)37)22-18-14-10-6-2)40-39-41-34-27-31(23-19-15-11-7-3)36(38)32(28-34)24-20-16-12-8-4/h25-28H,5-24,37-38H2,1-4H3.
What are the key properties of 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline?
4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline has a molecular weight of 601.02 g/mol, XLogP of 12.07, 24 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline is sourced from PubChem (CID 18450517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).