C36H60N2OS2 — CID 18450517
4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline (PubChem CID 18450517) has the molecular formula C36H60N2OS2 and a molecular weight of 601.02 g/mol. Its IUPAC name is 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline.
| Compound Name | 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline |
|---|---|
| PubChem CID | 18450517 |
| Molecular Formula | C36H60N2OS2 |
| Molecular Weight | 601.02 g/mol |
| Exact Mass | 600.41 |
| IUPAC Name | 4-(4-amino-3,5-dihexylphenyl)sulfanyloxysulfanyl-2,6-dihexylaniline |
| SMILES | CCCCCCc1cc(SOSc2cc(CCCCCC)c(N)c(CCCCCC)c2)cc(CCCCCC)c1N |
| InChI | InChI=1S/C36H60N2OS2/c1-5-9-13-17-21-29-25-33(26-30(35(29)37)22-18-14-10-6-2)40-39-41-34-27-31(23-19-15-11-7-3)36(38)32(28-34)24-20-16-12-8-4/h25-28H,5-24,37-38H2,1-4H3 |
| InChIKey | AFJNJMPGSNGIBQ-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.02 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|