C36H72O4S2Sn — CID 18508383
bis(6-methylheptyl)tin(2+);bis(2-(6-methylheptylsulfanyl)acetate) (PubChem CID 18508383) has the molecular formula C36H72O4S2Sn and a molecular weight of 751.81 g/mol. Its IUPAC name is bis(6-methylheptyl)tin(2+);bis(2-(6-methylheptylsulfanyl)acetate).
| Compound Name | bis(6-methylheptyl)tin(2+);bis(2-(6-methylheptylsulfanyl)acetate) |
|---|---|
| PubChem CID | 18508383 |
| Molecular Formula | C36H72O4S2Sn |
| Molecular Weight | 751.81 g/mol |
| Exact Mass | 752.39 |
| IUPAC Name | bis(6-methylheptyl)tin(2+);bis(2-(6-methylheptylsulfanyl)acetate) |
| SMILES | CC(C)CCCCCSCC(=O)[O-].CC(C)CCCCCSCC(=O)[O-].CC(C)CCCCC[Sn+2]CCCCCC(C)C |
| InChI | InChI=1S/2C10H20O2S.2C8H17.Sn/c2*1-9(2)6-4-3-5-7-13-8-10(11)12;2*1-4-5-6-7-8(2)3;/h2*9H,3-8H2,1-2H3,(H,11,12);2*8H,1,4-7H2,2-3H3;/q;;;;+2/p-2 |
| InChIKey | DQBXYOWPKCUHEI-UHFFFAOYSA-L |
| XLogP | 9.33 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.81 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|