C25H19F3N2O4S — CID 18532435
[(Z)-2-[1-ethyl-5-(trifluoromethylsulfonyl)benzimidazol-2-yl]-1-phenylethenyl] benzoate (PubChem CID 18532435) has the molecular formula C25H19F3N2O4S and a molecular weight of 500.50 g/mol. Its IUPAC name is [(Z)-2-[1-ethyl-5-(trifluoromethylsulfonyl)benzimidazol-2-yl]-1-phenylethenyl] benzoate.
| Compound Name | [(Z)-2-[1-ethyl-5-(trifluoromethylsulfonyl)benzimidazol-2-yl]-1-phenylethenyl] benzoate |
|---|---|
| PubChem CID | 18532435 |
| Molecular Formula | C25H19F3N2O4S |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | [(Z)-2-[1-ethyl-5-(trifluoromethylsulfonyl)benzimidazol-2-yl]-1-phenylethenyl] benzoate |
| SMILES | CCn1c(/C=C(\OC(=O)c2ccccc2)c2ccccc2)nc2cc(S(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C25H19F3N2O4S/c1-2-30-21-14-13-19(35(32,33)25(26,27)28)15-20(21)29-23(30)16-22(17-9-5-3-6-10-17)34-24(31)18-11-7-4-8-12-18/h3-16H,2H2,1H3/b22-16- |
| InChIKey | VPEGKCNSJZDXSW-JWGURIENSA-N |
| XLogP | 5.70 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|