C27H34FN5O3S — CID 18540805
3-[2-[(4-fluorophenyl)methylsulfanyl]-1-methyl-4-oxopyrimidin-5-yl]-N-octyl-3-(2-oxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 18540805) has the molecular formula C27H34FN5O3S and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-[2-[(4-fluorophenyl)methylsulfanyl]-1-methyl-4-oxopyrimidin-5-yl]-N-octyl-3-(2-oxo-1H-pyrimidin-5-yl)propanamide.
| Compound Name | 3-[2-[(4-fluorophenyl)methylsulfanyl]-1-methyl-4-oxopyrimidin-5-yl]-N-octyl-3-(2-oxo-1H-pyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 18540805 |
| Molecular Formula | C27H34FN5O3S |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 3-[2-[(4-fluorophenyl)methylsulfanyl]-1-methyl-4-oxopyrimidin-5-yl]-N-octyl-3-(2-oxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | CCCCCCCCNC(=O)CC(c1cnc(=O)[nH]c1)c1cn(C)c(SCc2ccc(F)cc2)nc1=O |
| InChI | InChI=1S/C27H34FN5O3S/c1-3-4-5-6-7-8-13-29-24(34)14-22(20-15-30-26(36)31-16-20)23-17-33(2)27(32-25(23)35)37-18-19-9-11-21(28)12-10-19/h9-12,15-17,22H,3-8,13-14,18H2,1-2H3,(H,29,34)(H,30,31,36) |
| InChIKey | GPABVVXXIQGEQP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|