C15H20F2O5 — CID 18597759
(3aR,5R,6S,6aR)-5-ethyl-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597759) has the molecular formula C15H20F2O5 and a molecular weight of 318.32 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-ethyl-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-ethyl-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597759 |
| Molecular Formula | C15H20F2O5 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-ethyl-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1oc(F)cc1C |
| InChI | InChI=1S/C15H20F2O5/c1-4-9-12(18-6-10-8(2)5-11(17)19-10)13-14(20-9)22-15(3,7-16)21-13/h5,9,12-14H,4,6-7H2,1-3H3/t9-,12+,13-,14-,15?/m1/s1 |
| InChIKey | YOUBPTDAULSBPV-HDAFYBPJSA-N |
| XLogP | 2.85 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |