C22H34F4O4 — CID 18600715
(3R,3aS,4S,6aR)-3-fluoro-4-[(E)-4-methyl-3-(oxan-2-yloxy)-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 18600715) has the molecular formula C22H34F4O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is (3R,3aS,4S,6aR)-3-fluoro-4-[(E)-4-methyl-3-(oxan-2-yloxy)-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3R,3aS,4S,6aR)-3-fluoro-4-[(E)-4-methyl-3-(oxan-2-yloxy)-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 18600715 |
| Molecular Formula | C22H34F4O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (3R,3aS,4S,6aR)-3-fluoro-4-[(E)-4-methyl-3-(oxan-2-yloxy)-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)(C(/C=C/[C@@H]1CC[C@H]2OC(O)[C@H](F)[C@@H]12)OC1CCCCO1)C(F)(F)F |
| InChI | InChI=1S/C22H34F4O4/c1-3-4-12-21(2,22(24,25)26)16(30-17-7-5-6-13-28-17)11-9-14-8-10-15-18(14)19(23)20(27)29-15/h9,11,14-20,27H,3-8,10,12-13H2,1-2H3/b11-9+/t14-,15+,16?,17?,18-,19+,20?,21?/m0/s1 |
| InChIKey | PBRMZJTWYZRRAW-KDSXVAIASA-N |
| XLogP | 5.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|