C32H45FO — CID 18609833
1-[4-[2-fluoro-4-(2-methylbutyl)phenyl]phenyl]-2-(4-heptylcyclohexyl)ethanone (PubChem CID 18609833) has the molecular formula C32H45FO and a molecular weight of 464.71 g/mol. Its IUPAC name is 1-[4-[2-fluoro-4-(2-methylbutyl)phenyl]phenyl]-2-(4-heptylcyclohexyl)ethanone.
| Compound Name | 1-[4-[2-fluoro-4-(2-methylbutyl)phenyl]phenyl]-2-(4-heptylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 18609833 |
| Molecular Formula | C32H45FO |
| Molecular Weight | 464.71 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | 1-[4-[2-fluoro-4-(2-methylbutyl)phenyl]phenyl]-2-(4-heptylcyclohexyl)ethanone |
| SMILES | CCCCCCCC1CCC(CC(=O)c2ccc(-c3ccc(CC(C)CC)cc3F)cc2)CC1 |
| InChI | InChI=1S/C32H45FO/c1-4-6-7-8-9-10-25-11-13-26(14-12-25)23-32(34)29-18-16-28(17-19-29)30-20-15-27(22-31(30)33)21-24(3)5-2/h15-20,22,24-26H,4-14,21,23H2,1-3H3 |
| InChIKey | DUIRJSKQHQTETN-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.71 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|