C14H18Cl2N2O2 — CID 18626625
2-(3,4-dichlorophenyl)-N-(methylcarbamoyl)hexanamide (PubChem CID 18626625) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(methylcarbamoyl)hexanamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(methylcarbamoyl)hexanamide |
|---|---|
| PubChem CID | 18626625 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(methylcarbamoyl)hexanamide |
| SMILES | CCCCC(C(=O)NC(=O)NC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-3-4-5-10(13(19)18-14(20)17-2)9-6-7-11(15)12(16)8-9/h6-8,10H,3-5H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | PMLLJKWFFRYTRA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |